Punicacortein B facts for kids
Quick facts for kids Punicacortein B |
|
---|---|
IUPAC name | (2R,3R)-3-[(14S,15S,19S)-2,3,4,7,8,9,19-Heptahydroxy-12,17-dioxo-13,16-dioxatetracyclo[13.3.1.05,18.06,11]nonadeca-1(18),2,4,6,8,10-hexaen-14-yl]-2,3-dihydroxypropyl 3,4,5-trihydroxybenzoate |
Identifiers | |
CAS number | |
PubChem | |
SMILES | Oc1cc(cc(O)c1O)C(=O)OC[C@@H](O)[C@@H](O)[C@@H]5OC(=O)c2cc(O)c(O)c(O)c2c3c(O)c(O)c(O)c4[C@H](O)[C@@H]5OC(=O)c34 |
Properties | |
Molecular formula | C27H22O18 |
Molar mass | 634.43 g/mol |
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) |
Punicacortein B is an ellagitannin, a polyphenol compound. It is found in the bark of Punica granatum (pomegranate).
All content from Kiddle encyclopedia articles (including the article images and facts) can be freely used under Attribution-ShareAlike license, unless stated otherwise. Cite this article:
Punicacortein B Facts for Kids. Kiddle Encyclopedia.