Butanone facts for kids
Quick facts for kids Butanone |
|
---|---|
![]() |
|
![]() |
|
Preferred IUPAC name
Butan-2-one
|
|
Other names |
|
Identifiers | |
CAS number | |
PubChem | |
KEGG | C02845 |
ChEBI | CHEBI:28398 |
RTECS number | EL6475000 |
SMILES | O=C(C)CC |
InChI
InChI=1/C4H8O/c1-3-4(2)5/h3H2,1-2H3
|
|
Beilstein Reference | 741880 |
Gmelin Reference | 25656 |
Properties | |
Molecular formula | |
Molar mass | 0 g mol-1 |
Appearance | Colorless liquid |
Odor | Mint or acetone-like |
Density | 0.8050 g/mL |
Melting point | |
Boiling point | |
27.5 g/100 mL | |
log P | 0.37 |
Vapor pressure | 78 mmHg (20 °C) |
Acidity (pKa) | 14.7 |
−45.58·10−6 cm3/mol | |
Refractive index (nD) | 1.37880 |
Viscosity | 0.43 cP |
Structure | |
Dipole moment | 2.76 D |
Hazards | |
EU classification | Flammable (F) Irritant (Xi) |
NFPA 704 |
|
R-phrases | R11 R36 R66 R67 |
S-phrases | (S2) S9 S16 |
Explosive limits | 1.4–11.4% |
U.S. Permissible exposure limit (PEL) |
TWA 200 ppm (590 mg/m3) |
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) |
Butanone, also called methyl ethyl ketone (MEK), is an organic compound with the chemical formula CH3C(O)CH2CH3. It is a simple ketone with four carbon atoms. It smells sharp and sweet, like butterscotch and acetone mixed. It is soluble in water and is used as a solvent.
See also
In Spanish: Butanona para niños
All content from Kiddle encyclopedia articles (including the article images and facts) can be freely used under Attribution-ShareAlike license, unless stated otherwise. Cite this article:
Butanone Facts for Kids. Kiddle Encyclopedia.